L-Leucine,N-(phenylmethyl)- structure
|
Common Name | L-Leucine,N-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 2743-42-2 | Molecular Weight | 221.29500 | |
| Density | 1.058g/cm3 | Boiling Point | 349.8ºC at 760mmHg | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.3ºC | |
| Name | N-Benzyl-L-leucin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.058g/cm3 |
|---|---|
| Boiling Point | 349.8ºC at 760mmHg |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.29500 |
| Flash Point | 165.3ºC |
| Exact Mass | 221.14200 |
| PSA | 49.33000 |
| LogP | 2.66640 |
| Vapour Pressure | 1.72E-05mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | ZJOWTIPPMQBTTA-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NCc1ccccc1)C(=O)O |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (S)-2-(benzylamino)-4-methylpentanoic acid |
| N-benzyl-L-leucine |
| (S)-N-benzylleucine |
| (S)-2-N-benzylamino-4-methylpentanoic acid |