4,6(1H,5H)-Pyrimidinedione,5-[(4-chlorophenyl)methylene]dihydro-2-thioxo- structure
|
Common Name | 4,6(1H,5H)-Pyrimidinedione,5-[(4-chlorophenyl)methylene]dihydro-2-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 27430-13-3 | Molecular Weight | 266.70300 | |
| Density | 1.54g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H7ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(4-chlorophenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Molecular Formula | C11H7ClN2O2S |
| Molecular Weight | 266.70300 |
| Exact Mass | 265.99200 |
| PSA | 90.29000 |
| LogP | 1.91190 |
| Index of Refraction | 1.704 |
| InChIKey | ZKRCZPXGHCOOLG-UHFFFAOYSA-N |
| SMILES | O=C1NC(=S)NC(=O)C1=Cc1ccc(Cl)cc1 |
|
~92%
4,6(1H,5H)-Pyri... CAS#:27430-13-3 |
| Literature: Luo, Youfu; Ma, Liang; Zheng, Hao; Chen, Lijuan; Li, Rui; He, Chunmei; Yang, Shengyong; Ye, Xia; Chen, Zhizhi; Li, Zicheng; Gao, Yan; Han, Jing; He, Gu; Yang, Li; Wei, Yuquan Journal of Medicinal Chemistry, 2010 , vol. 53, # 1 p. 273 - 281 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hms548b06 |