2-BROMO-2,3-DIHYDRO-5,6-DIMETHOXY-1H-INDEN-1-ONE structure
|
Common Name | 2-BROMO-2,3-DIHYDRO-5,6-DIMETHOXY-1H-INDEN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 2747-08-2 | Molecular Weight | 271.10700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-5,6-dimethoxy-2,3-dihydroinden-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11BrO3 |
|---|---|
| Molecular Weight | 271.10700 |
| Exact Mass | 269.98900 |
| PSA | 35.53000 |
| LogP | 2.20610 |
| InChIKey | NSPWDODUFKPVMO-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C(=O)C(Br)C2 |
| HS Code | 2914700090 |
|---|
|
~78%
2-BROMO-2,3-DIH... CAS#:2747-08-2 |
| Literature: O'Brien, Christopher J.; Nixon, Zachary S.; Holohan, Andrew J.; Kunkel, Stephen R.; Tellez, Jennifer L.; Doonan, Bryan J.; Coyle, Emma E.; Lavigne, Florie; Kang, Lauren J.; Przeworski, Katherine C. Chemistry - A European Journal, 2013 , vol. 19, # 45 p. 15281 - 15289 |
|
~%
2-BROMO-2,3-DIH... CAS#:2747-08-2 |
| Literature: Akzo N.V. Patent: US4705782 A1, 1987 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Brom-5,6-dimethoxy-indan-1-on |
| bromo-5,6-dimethoxy-indan-1-one |
| 2-bromo-5,6-dimethoxy-2,3-dihydro-1H-inden-1-one |
| BB_NC-2383 |
| 2-bromo-5,6-dimethoxy-indan-1-one |
| 2-bromo-5,6-dimethoxyindanone |
| 2-bromo-5,6-dimethoxy-1-indanone |