2-(4-Chlorophenyl)-4-thiazoleethanol structure
|
Common Name | 2-(4-Chlorophenyl)-4-thiazoleethanol | ||
|---|---|---|---|---|
| CAS Number | 27473-03-6 | Molecular Weight | 239.72100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10ClNOS |
|---|---|
| Molecular Weight | 239.72100 |
| Exact Mass | 239.01700 |
| PSA | 61.36000 |
| LogP | 2.99830 |
| InChIKey | GHXMYVMHRINCLZ-UHFFFAOYSA-N |
| SMILES | OCCc1csc(-c2ccc(Cl)cc2)n1 |
| HS Code | 2934100090 |
|---|
|
~99%
2-(4-Chlorophen... CAS#:27473-03-6 |
| Literature: ELI LILLY AND COMPANY Patent: WO2008/76562 A1, 2008 ; Location in patent: Page/Page column 22-23 ; WO 2008/076562 A1 |
|
~%
2-(4-Chlorophen... CAS#:27473-03-6 |
| Literature: Howe; Moore; Rao; Wood Journal of medicinal chemistry, 1972 , vol. 15, # 10 p. 1040 - 1045 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-(p-Chlorphenyl)-4-hydroxyethylthiazol |
| 2-(4-Chlorophenyl)-4-thiazoleethanol |
| 2-(4-chlorophenyl)-4-(2-hydroxyethyl)thiazole |
| 2-[2-(4-chlorophenyl)thiazol-4-yl]ethanol |
| 4-Thiazoleethanol,2-(p-chlorophenyl) |
| 4-Thiazoleethanol,2-(4-chlorophenyl) |