2-(4-chlorophenyl)-4-oxo-4-phenylbutanoic acid
Modify Date: 2025-08-25 08:02:19
2-(4-chlorophenyl)-4-oxo-4-phenylbutanoic acid structure
|
Common Name | 2-(4-chlorophenyl)-4-oxo-4-phenylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 39206-70-7 | Molecular Weight | 288.72600 | |
| Density | 1.3g/cm3 | Boiling Point | 484.6ºC at 760 mmHg | |
| Molecular Formula | C16H13ClO3 | Melting Point | 167-169ºC | |
| MSDS | N/A | Flash Point | 246.9ºC | |
| Name | 2-(4-chlorophenyl)-4-oxo-4-phenylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 484.6ºC at 760 mmHg |
| Melting Point | 167-169ºC |
| Molecular Formula | C16H13ClO3 |
| Molecular Weight | 288.72600 |
| Flash Point | 246.9ºC |
| Exact Mass | 288.05500 |
| PSA | 54.37000 |
| LogP | 3.78120 |
| Index of Refraction | 1.605 |
| InChIKey | PMMZTHWHCZULAV-UHFFFAOYSA-N |
| SMILES | O=C(CC(C(=O)O)c1ccc(Cl)cc1)c1ccccc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918300090 |
|
~%
2-(4-chlorophen... CAS#:39206-70-7 |
| Literature: Wali et al. Proceedings - Indian Academy of Sciences, Section A, 1941 , # 14 p. 139,143 |
|
~%
2-(4-chlorophen... CAS#:39206-70-7 |
| Literature: Attia, I. A. Egyptian Journal of Chemistry, 1994 , vol. 37, # 6 p. 627 - 633 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:39206-86-5| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (2R)-2-(4-chlorophenyl)-4-oxo-4-phenylbutanoic acid |
| 2-(4-chloro-phenyl)-4-oxo-4-phenyl-butyric acid |
| 2-(2-FUROYLAMINO)-1,3-THIAZOL-4-YL]ACETIC ACID |
| 2-(4-Chlor-phenyl)-4-oxo-4-phenyl-buttersaeure |