Mevalonic acid-13C,d3 sodium structure
|
Common Name | Mevalonic acid-13C,d3 sodium | ||
|---|---|---|---|---|
| CAS Number | 2747918-57-4 | Molecular Weight | 174.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C513CH8D3NaO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mevalonic acid-13C,d3 sodiumMevalonic acid-13C,d3 (sodium) is the 13C- and deuterium labeled[1]. |
| Name | Mevalonic acid-13C,d3 sodium |
|---|
| Description | Mevalonic acid-13C,d3 (sodium) is the 13C- and deuterium labeled[1]. |
|---|---|
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[11]. |
| References |
| Molecular Formula | C513CH8D3NaO4 |
|---|---|
| Molecular Weight | 174.15 |
| InChIKey | RIYNLCMADQUBEM-SPZGMPHYSA-M |
| SMILES | CC(O)(CCO)CC(=O)[O-].[Na+] |