1,2,4,5-Cyclohexanetetracarboxylic Dianhydride structure
|
Common Name | 1,2,4,5-Cyclohexanetetracarboxylic Dianhydride | ||
|---|---|---|---|---|
| CAS Number | 2754-41-8 | Molecular Weight | 224.167 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 517.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C10H8O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.6±30.2 °C | |
| Name | 3a,4,4a,7a,8,8a-hexahydrofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 517.5±50.0 °C at 760 mmHg |
| Molecular Formula | C10H8O6 |
| Molecular Weight | 224.167 |
| Flash Point | 238.6±30.2 °C |
| Exact Mass | 224.032089 |
| PSA | 86.74000 |
| LogP | -1.63 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | LJMPOXUWPWEILS-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)C2CC3C(=O)OC(=O)C3CC12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932190090 |
|
~%
1,2,4,5-Cyclohe... CAS#:2754-41-8 |
| Literature: Farbw. Hoechst Patent: DE855400 , 1943 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1,2,4,5-Cyclohexanetetracarboxylic Dianhydride |
| 1,2,4,5-Cyclohexanetetracarboxylic acid dianhydride |
| cyclohexane-1,2,4,5-tetracarboxylic acid-1,2,4,5-dianhydride |
| 1H,3H-Benzo[1,2-c:4,5-c']difuran-1,3,5,7-tetrone, hexahydro- |
| Tetrahydrobenzo[1,2-c:4,5-c']difuran-1,3,5,7(3aH,7aH)-tetraone |
| Hexahydro-1H,3H-furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| Cyclohexan-1,2,4,5-tetracarbonsaeure-1,2,4,5-dianhydrid |
| cyclohexanetetracarboxylic dianhydride |
| HPMDA |