ethenyl 2-(1,3-dioxoisoindol-2-yl)acetate
Modify Date: 2026-08-06 13:12:06
ethenyl 2-(1,3-dioxoisoindol-2-yl)acetate structure
|
Common Name | ethenyl 2-(1,3-dioxoisoindol-2-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 2756-76-5 | Molecular Weight | 231.20400 | |
| Density | 1.346g/cm3 | Boiling Point | 353ºC at 760mmHg | |
| Molecular Formula | C12H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.3ºC | |
| Name | ethenyl 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.346g/cm3 |
|---|---|
| Boiling Point | 353ºC at 760mmHg |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.20400 |
| Flash Point | 167.3ºC |
| Exact Mass | 231.05300 |
| PSA | 63.68000 |
| LogP | 0.90720 |
| Vapour Pressure | 3.7E-05mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | BDUPBVQZWCFKQY-UHFFFAOYSA-N |
| SMILES | C=COC(=O)CN1C(=O)c2ccccc2C1=O |
| HS Code | 2925190090 |
|---|
|
~%
ethenyl 2-(1,3-... CAS#:2756-76-5 |
| Literature: Nesmejanow; Perewalowa Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1954 , p. 1002,1003; engl. Ausg. S. 873, 874 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N,N-phthaloyl-glycine vinyl ester |
| N-Phthalyl-glycin-vinylester |
| 1,3-Dioxo-2-isoindolineacetic acid vinyl ester |
| 2-ISOINDOLINEACETIC ACID,1,3-DIOXO-,VINYL ESTER |
| N,N-Phthaloyl-glycin-vinylester |
| N-Phthaloylglycine vinyl ester |
| Phthaloylglycin-vinylester |