DIBAC-GGFG-NH2CH2-Dxd structure
|
Common Name | DIBAC-GGFG-NH2CH2-Dxd | ||
|---|---|---|---|---|
| CAS Number | 2758875-01-1 | Molecular Weight | 1128.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C61H58FN9O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DIBAC-GGFG-NH2CH2-DxdDIBAC-GGFG-NH2CH2-Dxd (compound LP4), a Camptothecin (HY-16560) derivative, is a linker-payload of protein-drug conjugates[1]. |
| Name | DIBAC-GGFG-NH2CH2-Dxd |
|---|
| Description | DIBAC-GGFG-NH2CH2-Dxd (compound LP4), a Camptothecin (HY-16560) derivative, is a linker-payload of protein-drug conjugates[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C61H58FN9O12 |
|---|---|
| Molecular Weight | 1128.16 |
| InChIKey | HXQAFVZJVFQLRZ-WEARVGGQSA-N |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(C)c3c1c2C(NC(=O)COCNC(=O)CNC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)CCC(=O)N1Cc2ccccc2C#Cc2ccccc21)CC3 |