6-methoxy-alpha-methylnaphthalen-1-acetaldehyde structure
|
Common Name | 6-methoxy-alpha-methylnaphthalen-1-acetaldehyde | ||
|---|---|---|---|---|
| CAS Number | 27602-75-1 | Molecular Weight | 214.26000 | |
| Density | 1.099 g/cm3 | Boiling Point | 356.8ºC at 760 mmHg | |
| Molecular Formula | C14H14O2 | Melting Point | 90-92ºC | |
| MSDS | N/A | Flash Point | 161.9ºC | |
| Name | 2-(6-methoxynaphthalen-2-yl)propanal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.099 g/cm3 |
|---|---|
| Boiling Point | 356.8ºC at 760 mmHg |
| Melting Point | 90-92ºC |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26000 |
| Flash Point | 161.9ºC |
| Exact Mass | 214.09900 |
| PSA | 26.30000 |
| LogP | 3.15080 |
| Vapour Pressure | 2.86E-05mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | RCGQAPUWWHXBOK-UHFFFAOYSA-N |
| SMILES | COc1ccc2cc(C(C)C=O)ccc2c1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| einecs 248-558-6 |