3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanesulphonyl chloride
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanesulphonyl chloride structure
|
Common Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanesulphonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 27619-89-2 | Molecular Weight | 446.61300 | |
| Density | 1.69g/cm3 | Boiling Point | 237.8ºC at 760mmHg | |
| Molecular Formula | C8H4ClF13O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 97.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.69g/cm3 |
|---|---|
| Boiling Point | 237.8ºC at 760mmHg |
| Molecular Formula | C8H4ClF13O2S |
| Molecular Weight | 446.61300 |
| Flash Point | 97.6ºC |
| Exact Mass | 445.94100 |
| PSA | 42.52000 |
| LogP | 5.76470 |
| Vapour Pressure | 0.0678mmHg at 25°C |
| Index of Refraction | 1.333 |
| InChIKey | NDBZVZPOTNLWLU-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2904909090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~96%
3,3,4,4,5,5,6,6... CAS#:27619-89-2 |
| Literature: Taylor, Charles Kenneth; Michalczyk, Michael Joseph; Acosta, Erick Jose Patent: US2009/42996 A1, 2009 ; Location in patent: Page/Page column 6-7 ; |
|
~%
3,3,4,4,5,5,6,6... CAS#:27619-89-2 |
| Literature: BAYER SCHERING PHARMA AKTIENGESELLSCHAFT; SRINIVASAN, Ananth; BERNDT, Mathias; GRAHAM, Keith; FRIEBE, Matthias; SCHMITT-WILLICH, Heribert Patent: WO2010/409 A2, 2010 ; Location in patent: Page/Page column 21-22 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H,1H,2H,2H-perfluoroctyl-1-sulfonic acid chloride |
| EINECS 248-576-4 |
| 1H,1H,2H,2H-perfluorooctyl sulfonyl chloride |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-n-octanesulfonyl chloride |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanesulphonyl chloride |
| perfluorohexyl ethyl sulfonyl chloride |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTANESULFONYL CHLORIDE |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanyl-1-sulfonylchloride |
| 2-(perfluorohexyl)ethanesulfonyl chloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride? |
| A: Molecular weight of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride is 446.61300. |
| Q: What is the polar surface area (PSA) of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride? |
| A: Polar surface area (PSA) of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride is 42.52000. |
| Q: What is the LogP of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride? |
| A: LogP of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride is 5.76470. |
| Q: What is the molecular formula of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride? |
| A: Molecular formula of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride is C8H4ClF13O2S. |
| Q: What is the InChIKey of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride? |
| A: InChIKey of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride is NDBZVZPOTNLWLU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride? |
| A: CAS number of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride is 27619-89-2. |
| Q: What is the English name of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride? |
| A: The English name of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride. |
| Q: What is the boiling point of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride? |
| A: Boiling point of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride is 237.8ºC at 760mmHg. |
| Q: What is the Chinese name of 27619-89-2? |
| A: Chinese name of 27619-89-2 is 27619-89-2. |
| Q: What are the upstream materials of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride? |
| A: Related upstream materials(CAS) of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonyl chloride: 26650-09-9;27619-97-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |