3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl thiocyanate structure
|
Common Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl thiocyanate | ||
|---|---|---|---|---|
| CAS Number | 26650-09-9 | Molecular Weight | 405.17900 | |
| Density | 1.585g/cm3 | Boiling Point | 221.253ºC at 760 mmHg | |
| Molecular Formula | C9H4F13NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.611ºC | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl thiocyanate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.585g/cm3 |
|---|---|
| Boiling Point | 221.253ºC at 760 mmHg |
| Molecular Formula | C9H4F13NS |
| Molecular Weight | 405.17900 |
| Flash Point | 87.611ºC |
| Exact Mass | 404.98600 |
| PSA | 49.09000 |
| LogP | 5.32958 |
| Vapour Pressure | 0.108mmHg at 25°C |
| Index of Refraction | 1.34 |
| InChIKey | RJSWEHLKQSQEHW-UHFFFAOYSA-N |
| SMILES | N#CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|
~92%
3,3,4,4,5,5,6,6... CAS#:26650-09-9 |
| Literature: CENTRE NATIONAL DE LA RECHERCHE SCIENTIFIQUE(C.N.R.S.) Patent: US2008/15255 A1, 2008 ; Location in patent: Page/Page column 7-8 ; |
|
~%
3,3,4,4,5,5,6,6... CAS#:26650-09-9 |
| Literature: Rondestvedt,C.S.; Thayer,G.L. Journal of Organic Chemistry, 1977 , vol. 42, p. 2680 - 2683 |
| 2-Perfluorohexylethanethiocyanate |
| 7H,7H,8H,8H,8H-tridecafluoro-8-thiocyanato-octane |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-n-octane thiocyanate |
| 2-(Perfluorohexyl)ethylthiocyanate |
| Thiocyanic acid,3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl ester |
| perfluorohexylethyl thiocyanate |
| 1H,1H,2H,2H-tridecafluoro-octyl thiocyanate |