Leucoside structure
|
Common Name | Leucoside | ||
|---|---|---|---|---|
| CAS Number | 27661-51-4 | Molecular Weight | 580.492 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 955.8±65.0 °C at 760 mmHg | |
| Molecular Formula | C26H28O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.1±27.8 °C | |
Use of LeucosideLeucoside is a natural compound isolated from tea seed extract[1]. |
| Name | 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 2-O-β-D-x ylopyranosyl-β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Leucoside is a natural compound isolated from tea seed extract[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 955.8±65.0 °C at 760 mmHg |
| Molecular Formula | C26H28O15 |
| Molecular Weight | 580.492 |
| Flash Point | 320.1±27.8 °C |
| Exact Mass | 580.142822 |
| PSA | 249.20000 |
| LogP | 2.33 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.760 |
| InChIKey | RXAXTTGJEMODPY-CJNLAGEVSA-N |
| SMILES | O=c1c(OC2OC(CO)C(O)C(O)C2OC2OCC(O)C(O)C2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| Hazard Codes | Xi |
|---|
| 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]- |
| 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 2-O-β-D-xylopyranosyl-β-D-glucopyranoside |
| Leucoside |