2-Butenamide,N,3-diphenyl- structure
|
Common Name | 2-Butenamide,N,3-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 27687-45-2 | Molecular Weight | 237.29600 | |
| Density | 1.123g/cm3 | Boiling Point | 430.2ºC at 760mmHg | |
| Molecular Formula | C16H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.1ºC | |
| Name | (Z)-N,3-diphenylbut-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.123g/cm3 |
|---|---|
| Boiling Point | 430.2ºC at 760mmHg |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.29600 |
| Flash Point | 260.1ºC |
| Exact Mass | 237.11500 |
| PSA | 29.10000 |
| LogP | 3.80160 |
| Vapour Pressure | 1.32E-07mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | HRSFRXQUPFPNSL-SEYXRHQNSA-N |
| SMILES | CC(=CC(=O)Nc1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Methyl-cinnamanilid |
| 3-phenyl-crotonic acid anilide |
| 3-Phenyl-crotonsaeure-anilid |
| 3-Phenyl-cis-crotonsaeure-anilid |