Hypolaetin structure
|
Common Name | Hypolaetin | ||
|---|---|---|---|---|
| CAS Number | 27696-41-9 | Molecular Weight | 302.23600 | |
| Density | 1.763g/cm3 | Boiling Point | 653.3ºC at 760mmHg | |
| Molecular Formula | C15H10O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.3ºC | |
| Name | hypolaetin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.763g/cm3 |
|---|---|
| Boiling Point | 653.3ºC at 760mmHg |
| Molecular Formula | C15H10O7 |
| Molecular Weight | 302.23600 |
| Flash Point | 252.3ºC |
| Exact Mass | 302.04300 |
| PSA | 131.36000 |
| LogP | 1.98800 |
| Vapour Pressure | 1.14E-17mmHg at 25°C |
| Index of Refraction | 1.804 |
| InChIKey | ASOIXDIITRKTOX-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccc(O)c(O)c2)oc2c(O)c(O)cc(O)c12 |
| HS Code | 2914501900 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914501900 |
|---|---|
| Summary | 2914501900 other ketone-phenols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: Inhibition of Avian myeloblastosis virus reverse transcriptase
Source: ChEMBL
Target: Polyprotein II
External Id: CHEMBL3047467
|
| 2-(3,4-Dihydroxy-phenyl)-5,7,8-trihydroxy-chromen-4-on |
| 3',4',5,7,8-pentahydroxyflavone |
| 5,7,8,3',4'-pentahydroxyflavone |
| 8-hydroxyluteolin |
| Hypolaetin |
| 2-(3,4-dihydroxy-phenyl)-5,7,8-trihydroxy-chromen-4-one |
| 2-(3,4-dihydroxyphenyl)-5,7,8-trihydroxy-4H-chromen-4-one |
| 2-(3,4-dihydroxyphenyl)-5,7,8-trihydroxychromen-4-one |