Isosinensetin structure
|
Common Name | Isosinensetin | ||
|---|---|---|---|---|
| CAS Number | 17290-70-9 | Molecular Weight | 372.369 | |
| Density | 1.244±0.06 g/cm3 (20 ºC 760 Torr) | Boiling Point | 565.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H20O7 | Melting Point | 198-199 ºC | |
| MSDS | N/A | Flash Point | 248.4±30.2 °C | |
Use of IsosinensetinIsosinensetin, a polymethoxylated flavone extracted from pericarpium citri reticulatae viride, exhibits inhibition on P-glycoprotein (P-gp) in MDR1-MDCKII cells[1][2]. |
| Name | 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Isosinensetin, a polymethoxylated flavone extracted from pericarpium citri reticulatae viride, exhibits inhibition on P-glycoprotein (P-gp) in MDR1-MDCKII cells[1][2]. |
|---|---|
| Related Catalog | |
| Target |
P-glycoprotein[2] |
| References |
| Density | 1.244±0.06 g/cm3 (20 ºC 760 Torr) |
|---|---|
| Boiling Point | 565.3±50.0 °C at 760 mmHg |
| Melting Point | 198-199 ºC |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.369 |
| Flash Point | 248.4±30.2 °C |
| Exact Mass | 372.120911 |
| PSA | 76.36000 |
| LogP | 2.88 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | UYCWETIUOAGWIL-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)cc(OC)c(OC)c3o2)cc1OC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(3,4-Dimethoxyphenyl)-5,7,8-trimethoxy-4H-chromen-4-one |
| 6-Demethoxynobiletin |
| UNII-63Z99S38LE |
| 5,7,8,3',4'-pentamethoxyflavone |
| Isosinensetin |
| 3',4',5,7,8-Pentamethoxyflavone |
| 4H-1-Benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxy- |