Benzaldehyde, p-nitro-,1,4-phthalazinediyldihydrazone (8CI) structure
|
Common Name | Benzaldehyde, p-nitro-,1,4-phthalazinediyldihydrazone (8CI) | ||
|---|---|---|---|---|
| CAS Number | 27702-29-0 | Molecular Weight | 456.41400 | |
| Density | 1.46g/cm3 | Boiling Point | 767.9ºC at 760mmHg | |
| Molecular Formula | C22H16N8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 418.2ºC | |
| Name | 1-N,4-N-bis[(E)-(4-nitrophenyl)methylideneamino]phthalazine-1,4-diamine |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 767.9ºC at 760mmHg |
| Molecular Formula | C22H16N8O4 |
| Molecular Weight | 456.41400 |
| Flash Point | 418.2ºC |
| Exact Mass | 456.12900 |
| PSA | 172.66000 |
| LogP | 4.22840 |
| Vapour Pressure | 1.7E-23mmHg at 25°C |
| Index of Refraction | 1.723 |
| InChIKey | UEFMURWQWOUWFY-RNIAWFEPSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=NNc2nnc(NN=Cc3ccc([N+](=O)[O-])cc3)c3ccccc23)cc1 |
|
~80%
Benzaldehyde, p... CAS#:27702-29-0 |
| Literature: Prakash, Om; Aneja, Deepak K.; Arora, Sanjiv; Hussain, Khalid; Kumar, Ravi; Sharma, Chetan; Aneja, Kamal R. Journal of Heterocyclic Chemistry, 2012 , vol. 49, # 5 p. 1091 - 1097,7 |
|
~%
Benzaldehyde, p... CAS#:27702-29-0 |
| Literature: Prakash, Om; Aneja, Deepak K.; Arora, Sanjiv; Hussain, Khalid; Kumar, Ravi; Sharma, Chetan; Aneja, Kamal R. Journal of Heterocyclic Chemistry, 2012 , vol. 49, # 5 p. 1091 - 1097,7 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |