1,3-dimorpholin-4-ylpropane-1,3-dithione structure
|
Common Name | 1,3-dimorpholin-4-ylpropane-1,3-dithione | ||
|---|---|---|---|---|
| CAS Number | 27759-71-3 | Molecular Weight | 274.40300 | |
| Density | 1.304g/cm3 | Boiling Point | 411.1ºC at 760 mmHg | |
| Molecular Formula | C11H18N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | 1,3-dimorpholin-4-ylpropane-1,3-dithione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 411.1ºC at 760 mmHg |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.40300 |
| Flash Point | 202.4ºC |
| Exact Mass | 274.08100 |
| PSA | 89.12000 |
| LogP | 0.57150 |
| Vapour Pressure | 5.73E-07mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | CGOCUAQIVLLXCA-UHFFFAOYSA-N |
| SMILES | S=C(CC(=S)N1CCOCC1)N1CCOCC1 |
|
~54%
1,3-dimorpholin... CAS#:27759-71-3 |
| Literature: Motte-Coppe, G.; Dutron-Woitrin, F,; Bird, T. G. C.; Viehe, H. G.; Declercq, J. P.; et al. Tetrahedron, 1985 , vol. 41, # 4 p. 693 - 698 |
|
~30%
1,3-dimorpholin... CAS#:27759-71-3 |
| Literature: Darabi, Hossein Reza; Aghapoor, Kioumars; Nakhshab, Leila Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, 2004 , vol. 59, # 5 p. 601 - 605 |
|
~29%
1,3-dimorpholin... CAS#:27759-71-3 |
| Literature: Dutron-Woitrin, Francoise; Merenyi, Robert; Viehe, Heinz G. Synthesis, 1985 , # 1 p. 77 - 79 |
|
~84%
1,3-dimorpholin... CAS#:27759-71-3 |
| Literature: Hartke, Klaus; Rettberg, Norbert; Dutta, Dinah; Gerber, Hans-Dieter Liebigs Annalen der Chemie, 1993 , # 10 p. 1081 - 1090 |
|
~%
1,3-dimorpholin... CAS#:27759-71-3 |
| Literature: Darabi, Hossein Reza; Aghapoor, Kioumars; Nakhshab, Leila Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, 2004 , vol. 59, # 5 p. 601 - 605 |
| 1,3-Dimorpholino-1,3-propanedithione |
| Dimorpholinomalonodithioamide |
| bis(morpholyl)dithiomalonamide |
| 1,3-di(morpholin-4-yl)propane-1,3-dithione |
| 1,3-Dimorpholino-propan-1,3-dithion |
| 4,4'-dithiomalonyl-bis-morpholine |
| Dithiomalonsaeuredimorpholid |
| dimorpholinodithioacetylacetonate |
| 1,3-Propanedithione,1,3-dimorpholino |