5-Hydroxy-1-methoxy-9H-xanthen-9-one structure
|
Common Name | 5-Hydroxy-1-methoxy-9H-xanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 27770-13-4 | Molecular Weight | 242.227 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 440.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.4±22.2 °C | |
| Name | 5-hydroxy-1-methoxyxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 440.8±45.0 °C at 760 mmHg |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.227 |
| Flash Point | 173.4±22.2 °C |
| Exact Mass | 242.057907 |
| PSA | 59.67000 |
| LogP | 2.36 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | GCAMSSLNXVYMKS-UHFFFAOYSA-N |
| SMILES | COc1cccc2oc3c(O)cccc3c(=O)c12 |
| Hazard Codes | Xi |
|---|
|
Name: Concentration required to inhibit monoamine oxidase activity by 50%
Source: ChEMBL
Target: Amine oxidase [flavin-containing] A
External Id: CHEMBL827909
|
| 1-methoxy-5-hydroxyxanthone |
| 5-hydroxy-1-methoxyxanthone |
| 9H-Xanthen-9-one,5-hydroxy-1-methoxy |
| 5-Hydroxy-1-methoxy-9H-xanthen-9-one |
| 5-hydroxy-1-methoxy-xanthen-9-one |