5-Hydroxy-1-methoxy-9H-xanthen-9-one
5-Hydroxy-1-methoxy-9H-xanthen-9-one structure
|
Common Name | 5-Hydroxy-1-methoxy-9H-xanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 27770-13-4 | Molecular Weight | 242.227 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 440.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.4±22.2 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-hydroxy-1-methoxyxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 440.8±45.0 °C at 760 mmHg |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.227 |
| Flash Point | 173.4±22.2 °C |
| Exact Mass | 242.057907 |
| PSA | 59.67000 |
| LogP | 2.36 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | GCAMSSLNXVYMKS-UHFFFAOYSA-N |
| SMILES | COc1cccc2oc3c(O)cccc3c(=O)c12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Concentration required to inhibit monoamine oxidase activity by 50%
Source: ChEMBL
Target: Amine oxidase [flavin-containing] A
External Id: CHEMBL827909
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-methoxy-5-hydroxyxanthone |
| 5-hydroxy-1-methoxyxanthone |
| 9H-Xanthen-9-one,5-hydroxy-1-methoxy |
| 5-Hydroxy-1-methoxy-9H-xanthen-9-one |
| 5-hydroxy-1-methoxy-xanthen-9-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-hydroxy-1-methoxyxanthen-9-one? |
| A: The English name of 5-hydroxy-1-methoxyxanthen-9-one is 5-hydroxy-1-methoxyxanthen-9-one. |
| Q: What is the CAS number of 5-hydroxy-1-methoxyxanthen-9-one? |
| A: CAS number of 5-hydroxy-1-methoxyxanthen-9-one is 27770-13-4. |
| Q: What is the SMILES notation of 5-hydroxy-1-methoxyxanthen-9-one? |
| A: SMILES notation of 5-hydroxy-1-methoxyxanthen-9-one is COc1cccc2oc3c(O)cccc3c(=O)c12. |
| Q: What is the boiling point of 5-hydroxy-1-methoxyxanthen-9-one? |
| A: Boiling point of 5-hydroxy-1-methoxyxanthen-9-one is 440.8±45.0 °C at 760 mmHg. |
| Q: What English synonyms does 5-hydroxy-1-methoxyxanthen-9-one have? |
| A: English synonyms of 5-hydroxy-1-methoxyxanthen-9-one: 1-methoxy-5-hydroxyxanthone, 5-hydroxy-1-methoxyxanthone, 9H-Xanthen-9-one,5-hydroxy-1-methoxy, 5-Hydroxy-1-methoxy-9H-xanthen-9-one, 5-hydroxy-1-methoxy-xanthen-9-one. |
| Q: What is the molecular weight of 5-hydroxy-1-methoxyxanthen-9-one? |
| A: Molecular weight of 5-hydroxy-1-methoxyxanthen-9-one is 242.227. |
| Q: What is the polar surface area (PSA) of 5-hydroxy-1-methoxyxanthen-9-one? |
| A: Polar surface area (PSA) of 5-hydroxy-1-methoxyxanthen-9-one is 59.67000. |
| Q: What is the InChIKey of 5-hydroxy-1-methoxyxanthen-9-one? |
| A: InChIKey of 5-hydroxy-1-methoxyxanthen-9-one is GCAMSSLNXVYMKS-UHFFFAOYSA-N. |
| Q: What is the LogP of 5-hydroxy-1-methoxyxanthen-9-one? |
| A: LogP of 5-hydroxy-1-methoxyxanthen-9-one is 2.36. |
| Q: What is the molecular formula of 5-hydroxy-1-methoxyxanthen-9-one? |
| A: Molecular formula of 5-hydroxy-1-methoxyxanthen-9-one is C14H10O4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| BioBioPha |
| Dayang Chem (Hangzhou) Co., Ltd. |