endothion structure
|
Common Name | endothion | ||
|---|---|---|---|---|
| CAS Number | 2778-04-3 | Molecular Weight | 280.23500 | |
| Density | 1.35g/cm3 | Boiling Point | 411.3ºC at 760mmHg | |
| Molecular Formula | C9H13O6PS | Melting Point | 96ºC | |
| MSDS | N/A | Flash Point | 202.5ºC | |
Use of endothionEndothion, a systemic insecticide, has been used for agricultural and horticultural areas. Endothion can prevent Mediterranean Drosophila on peaches, and the residual effect lasts for more than 3 weeks without toxicity to leaves and fruits[1][2]. |
| Name | endothion |
|---|---|
| Synonym | More Synonyms |
| Description | Endothion, a systemic insecticide, has been used for agricultural and horticultural areas. Endothion can prevent Mediterranean Drosophila on peaches, and the residual effect lasts for more than 3 weeks without toxicity to leaves and fruits[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 411.3ºC at 760mmHg |
| Melting Point | 96ºC |
| Molecular Formula | C9H13O6PS |
| Molecular Weight | 280.23500 |
| Flash Point | 202.5ºC |
| Exact Mass | 280.01700 |
| PSA | 110.08000 |
| LogP | 2.28250 |
| Vapour Pressure | 5.65E-07mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | YCAGGFXSFQFVQL-UHFFFAOYSA-N |
| SMILES | COc1coc(CSP(=O)(OC)OC)cc1=O |
| Hazard Codes | T |
|---|---|
| Risk Phrases | 24/25 |
| Safety Phrases | S45;S36/S37 |
| RIDADR | UN 2783 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2932999013 |
|
~%
endothion CAS#:2778-04-3 |
| Literature: Soc. Usines Chim. Rhone-Poulenc Patent: US2811476 , 1956 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999013 |
|---|---|
| Summary | 2932999013 s-((5-methoxy-4-oxo-4h-pyran-2-yl)methyl) o,o-dimethyl phosphorothioate。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:13.0%。MFN tarrif:6.5%。general tariff:20.0% |
| Exothion |
| S-5-methoxy-4-oxo-4H-pyran-2-ylmethyl O,O-dimethyl phosphorothioate |
| ENDOTHION |
| Caswell No. 422 |
| 2-(dimethoxyphosphorylsulfanylmethyl)-5-methoxypyran-4-one |
| Endothion [ISO] |
| Niagara 5767 |
| Endocid |
| Phosphate 100 |
| S-[(5-methoxy-4-oxo-4H-pyran-2-yl)methyl] O,O-dimethyl phosphorothioate |
| Endocide |
| Phosphopyron |
| 2-(Dimethoxyphosphorylmercapto-methyl)-5-methoxy-pyran-4-on |
| Phosphopyrone |
| 2-dimethoxyphosphinoylthiomethyl-5-methoxypyran-4-one |
| 2-(dimethoxyphosphorylsulfanyl-methyl)-5-methoxy-pyran-4-one |
| EINECS 220-472-3 |