Phenylphosphonic acid bis(1-methylpropyl) ester structure
|
Common Name | Phenylphosphonic acid bis(1-methylpropyl) ester | ||
|---|---|---|---|---|
| CAS Number | 2783-48-4 | Molecular Weight | 270.30400 | |
| Density | 1.03g/cm3 | Boiling Point | 337.7ºC at 760mmHg | |
| Molecular Formula | C14H23O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.8ºC | |
| Name | di(butan-2-yloxy)phosphorylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 337.7ºC at 760mmHg |
| Molecular Formula | C14H23O3P |
| Molecular Weight | 270.30400 |
| Flash Point | 171.8ºC |
| Exact Mass | 270.13800 |
| PSA | 45.34000 |
| LogP | 4.13520 |
| Vapour Pressure | 0.000202mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | LVHRUHVOYXWOMW-UHFFFAOYSA-N |
| SMILES | CCC(C)OP(=O)(OC(C)CC)c1ccccc1 |
| HS Code | 2931900090 |
|---|
|
~95%
Phenylphosphoni... CAS#:2783-48-4 |
| Literature: Nitta, Yoshihiro; Arakawa, Yasushi Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 8 p. 3121 - 3129 |
|
~0%
Phenylphosphoni... CAS#:2783-48-4
Detail
|
| Literature: Nitta, Yoshihiro; Arakawa, Yasushi Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 8 p. 3121 - 3129 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| di-sec-butyl phenylphosphonate |
| DIBUTAN-2-YLOXYPHOSPHORYLBENZENE |
| Phenylphosphonsaeure-di-sek.-butyl-ester |
| Phosphonic acid,phenyl-,bis(1-methylpropyl) ester |