Malonic acid bis(1-methylpropyl) ester structure
|
Common Name | Malonic acid bis(1-methylpropyl) ester | ||
|---|---|---|---|---|
| CAS Number | 32260-07-4 | Molecular Weight | 216.27400 | |
| Density | 0.992g/cm3 | Boiling Point | 237.8ºC at 760 mmHg | |
| Molecular Formula | C11H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.1ºC | |
| Name | dibutan-2-yl propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.992g/cm3 |
|---|---|
| Boiling Point | 237.8ºC at 760 mmHg |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.27400 |
| Flash Point | 103.1ºC |
| Exact Mass | 216.13600 |
| PSA | 52.60000 |
| LogP | 2.05990 |
| Index of Refraction | 1.431 |
| InChIKey | QQXQNPKZBSJJTA-UHFFFAOYSA-N |
| SMILES | CCC(C)OC(=O)CC(=O)OC(C)CC |
| HS Code | 2917190090 |
|---|
|
~92%
Malonic acid bi... CAS#:32260-07-4 |
| Literature: Xia, Chun-Nian; Hu, Wei-Xiao Journal of Chemical Research, 2005 , # 5 p. 332 - 334 |
|
~%
Malonic acid bi... CAS#:32260-07-4 |
| Literature: Frank et al. Journal of the American Chemical Society, 1944 , vol. 66, p. 1510 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Malonsaeure-di-sec.-butylester |
| di-sec-butyl malonate |
| Malonic acid,di-sec-butyl ester |