2,3,5,6-TETRAFLUORO-4-(TRIFLUOROMETHYL)PHENOL structure
|
Common Name | 2,3,5,6-TETRAFLUORO-4-(TRIFLUOROMETHYL)PHENOL | ||
|---|---|---|---|---|
| CAS Number | 2787-79-3 | Molecular Weight | 234.07100 | |
| Density | 1.713 g/mL at 25 °C(lit.) | Boiling Point | 163-164 °C(lit.) | |
| Molecular Formula | C7HF7O | Melting Point | 25°C | |
| MSDS | Chinese USA | Flash Point | 179 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.713 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 163-164 °C(lit.) |
| Melting Point | 25°C |
| Molecular Formula | C7HF7O |
| Molecular Weight | 234.07100 |
| Flash Point | 179 °F |
| Exact Mass | 233.99200 |
| PSA | 20.23000 |
| LogP | 2.96740 |
| Vapour Pressure | 1.53mmHg at 25°C |
| Index of Refraction | n20/D 1.414(lit.) |
| InChIKey | HZQGKHUTYHEFBT-UHFFFAOYSA-N |
| SMILES | Oc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2908199090 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
|
[18F]/19F exchange in fluorine containing compounds for potential use in 18F-labelling strategies. Blom E, et al.
J. Labelled Comp. Radiopharm. 52(12) , 504-511, (2009)
|
|
|
Yaws CL.
The Yaws Handbook of Physical Properties for Hydrocarbons and Chemicals 2nd ed.,, (2015), 133
|
|
|
Knunyants IL and Yakobson GG.
Syntheses of Fluoroorganic Compounds , (1985), 171-172
|
| Heptafluor-p-kresol |
| 4-Hydroxy-2,3,5,6-tetrafluorobenzotrifluoride |
| Perfluoro-p-cresol |
| 4-Trifluoromethyl-2,3,5,6-tetrafluorophenol |
| 2,3,5,6-Tetrafluoro-4-hydroxybenzotrifluoride |
| 2,3,5,6-Tetrafluoro-4-(trifluoroMethyl)phenol |
| 2,3,5,6-Tetrafluor-4-trifluormethylphenol |
| p-CF3-C6F4OH |
| p-Trifluormethyltetrafluorphenol |
| 4-trifluoromethyltetrafluorophenol |
| 2,3,4,5-TETRAFLUORO-BENZAMIDINE |
| α,α,α,2,3,5,6-Heptafluoro-p-cresol |
| MFCD00155984 |