Methyl 4-hydroxy-5-methoxy-2-nitrobenzoate structure
|
Common Name | Methyl 4-hydroxy-5-methoxy-2-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 27883-60-9 | Molecular Weight | 227.171 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 389.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H9NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.2±27.9 °C | |
| Name | methyl 4-hydroxy-5-methoxy-2-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 389.2±42.0 °C at 760 mmHg |
| Molecular Formula | C9H9NO6 |
| Molecular Weight | 227.171 |
| Flash Point | 189.2±27.9 °C |
| Exact Mass | 227.042984 |
| PSA | 101.58000 |
| LogP | 1.88 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | SKKNLIAUOSEGNQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c(O)cc1[N+](=O)[O-] |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid, 4-hydroxy-5-methoxy-2-nitro-, methyl ester |
| Methyl 4-hydroxy-5-methoxy-2-nitrobenzoate |
| 4-hydroxy-5-methoxy-2-nitro-benzoic acid methyl ester |