Benzoic acid,4-[[[[4-[bis(2-chloroethyl)amino]phenyl]amino]carbonyl]oxy]- structure
|
Common Name | Benzoic acid,4-[[[[4-[bis(2-chloroethyl)amino]phenyl]amino]carbonyl]oxy]- | ||
|---|---|---|---|---|
| CAS Number | 27885-40-1 | Molecular Weight | 397.25300 | |
| Density | 1.415g/cm3 | Boiling Point | 565.9ºC at 760 mmHg | |
| Molecular Formula | C18H18Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296ºC | |
| Name | 4-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoyloxy]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 565.9ºC at 760 mmHg |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.25300 |
| Flash Point | 296ºC |
| Exact Mass | 396.06400 |
| PSA | 78.87000 |
| LogP | 4.35270 |
| Vapour Pressure | 1.21E-13mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | RWZZWCAYIBQMHS-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(N(CCCl)CCCl)cc1)Oc1ccc(C(=O)O)cc1 |
|
~%
Benzoic acid,4-... CAS#:27885-40-1 |
|
Literature: Owen,L.N.; Sridhar,R. Journal of the Chemical Society [Section] C: Organic, 1970 , vol. |
|
~%
Benzoic acid,4-... CAS#:27885-40-1 |
|
Literature: Owen,L.N.; Sridhar,R. Journal of the Chemical Society [Section] C: Organic, 1970 , vol. |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Carbanilic acid,ester with p-hydroxybenzoic acid |