4-Methoxycarbonyl phenyl chloroformate structure
|
Common Name | 4-Methoxycarbonyl phenyl chloroformate | ||
|---|---|---|---|---|
| CAS Number | 31140-40-6 | Molecular Weight | 214.602 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 283.3±23.0 °C at 760 mmHg | |
| Molecular Formula | C9H7ClO4 | Melting Point | 51-54ºC | |
| MSDS | Chinese USA | Flash Point | 120.0±21.6 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | methyl 4-carbonochloridoyloxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 283.3±23.0 °C at 760 mmHg |
| Melting Point | 51-54ºC |
| Molecular Formula | C9H7ClO4 |
| Molecular Weight | 214.602 |
| Flash Point | 120.0±21.6 °C |
| Exact Mass | 214.003281 |
| PSA | 52.60000 |
| LogP | 2.89 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | PPVBQEZMYRAXPV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OC(=O)Cl)cc1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| RIDADR | UN 3261 8/PG 2 |
| Packaging Group | III |
| HS Code | 2918990090 |
|
~%
4-Methoxycarbon... CAS#:31140-40-6 |
| Literature: DE224160 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 10, p. 1090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-chlorocarbonyloxy-benzoic acid methyl ester |
| Methyl 4-((chlorocarbonyl)oxy)benzoate |
| 4-METHOXYCARBONYLPHENYLCHLOROFORMATE |
| p-methoxycarbonylphenyl chloroformate |
| Kohlensaeure-(4-carbomethoxy-phenylester)-chlorid |
| Methyl 4-chlorocarbonyloxybenzoate |
| EINECS 250-483-9 |
| Benzoic acid, 4-[(chlorocarbonyl)oxy]-, methyl ester |
| Methyl 4-[(chlorocarbonyl)oxy]benzoate |
| 4-methyloxycarbonylphenyl chloroformate |
| 4-Chlorcarbonyloxy-benzoesaeure-methylester |
| 4-Methoxycarbonyl phenyl chloroformate |