4-amino-2,5-dimethylbenzenesulfonic acid structure
|
Common Name | 4-amino-2,5-dimethylbenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 27897-08-1 | Molecular Weight | 201.24300 | |
| Density | 1.368g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-2,5-dimethylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.368g/cm3 |
|---|---|
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.24300 |
| Exact Mass | 201.04600 |
| PSA | 88.77000 |
| LogP | 2.79430 |
| Index of Refraction | 1.595 |
| InChIKey | QTYQPEBQHHUSIK-UHFFFAOYSA-N |
| SMILES | Cc1cc(S(=O)(=O)O)c(C)cc1N |
| HS Code | 2921430090 |
|---|
|
~80%
4-amino-2,5-dim... CAS#:27897-08-1 |
| Literature: Beimling, Peter; Kossmehl, Gerhard Chemische Berichte, 1986 , vol. 119, # 10 p. 3198 - 3203 |
|
~%
4-amino-2,5-dim... CAS#:27897-08-1 |
| Literature: Kanetani, Fujio; Yamaguchi, Hachiro Bulletin of the Chemical Society of Japan, 1981 , vol. 54, # l0 p. 3048 - 3058 |
|
~%
4-amino-2,5-dim... CAS#:27897-08-1 |
| Literature: Noelting; Witt; Forel Chemische Berichte, 1885 , vol. 18, p. 2665 Full Text Show Details Noelting; Kohn Chemische Berichte, 1886 , vol. 19, p. 141 |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-amino-2,5-dimethyl-benzenesulfonic acid |
| 4-Amino-2,5-xylenesulfonic acid |
| 2.5-Dimethylanilin-4-sulfonsaeure |
| 5-Amino-p-xylol-sulfonsaeure-(2) |
| EINECS 248-718-5 |
| 2,5-Dimethylsulfanilic acid |
| 4-Amino-2,5-dimethyl-benzolsulfonsaeure |
| 2-AMINO-4-(ETHYLSULFONYL)PHENOL |
| 2,5-dimethylaniline-4-sulfonic acid |
| 2-Amino-p-xylol-5-sulfonsaeure |
| 2,5-Dimethylsulphanilic acid |