4-chloro-2,5-dimethylbenzenesulfonyl chloride
Modify Date: 2025-08-24 19:06:07
4-chloro-2,5-dimethylbenzenesulfonyl chloride structure
|
Common Name | 4-chloro-2,5-dimethylbenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 88-49-3 | Molecular Weight | 239.11900 | |
| Density | 1.401g/cm3 | Boiling Point | 317.5ºC at 760 mmHg | |
| Molecular Formula | C8H8Cl2O2S | Melting Point | 48 °C | |
| MSDS | USA | Flash Point | 145.8ºC | |
| Name | 4-chloro-2,5-dimethylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.401g/cm3 |
|---|---|
| Boiling Point | 317.5ºC at 760 mmHg |
| Melting Point | 48 °C |
| Molecular Formula | C8H8Cl2O2S |
| Molecular Weight | 239.11900 |
| Flash Point | 145.8ºC |
| Exact Mass | 237.96200 |
| PSA | 42.52000 |
| LogP | 3.96510 |
| Index of Refraction | 1.551 |
| InChIKey | JBYZPUBAISWVDI-UHFFFAOYSA-N |
| SMILES | Cc1cc(S(=O)(=O)Cl)c(C)cc1Cl |
| Hazard Codes | Xi: Irritant;C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | 3261 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
|
~%
4-chloro-2,5-di... CAS#:88-49-3 |
| Literature: Journal of the American Chemical Society, , vol. 56, p. 1132 |
|
~%
4-chloro-2,5-di... CAS#:88-49-3 |
| Literature: US1832209 , ; |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Chlor-2,5-dimethyl-benzolsulfonylchlorid |
| 4-chloro-2,5-dimethylphenylsulfonyl chloride |
| 5-Chloro-p-xylene-2-sulphonyl chloride |
| EINECS 201-835-5 |
| 5-chloro-p-xylene-2-sulfonyl chloride |
| 4-Chloro-2,5-dimethylbenzene-1-sulfonyl chloride |
| 4-chloro-2,5-dimethyl-benzenesulfonyl chloride |
| chloro(4-chloro-2,5-dimethylphenyl)sulfone |
| MFCD00044017 |