N-(5-Chloro-2-hydroxyphenyl)carbamic acid isopropyl ester structure
|
Common Name | N-(5-Chloro-2-hydroxyphenyl)carbamic acid isopropyl ester | ||
|---|---|---|---|---|
| CAS Number | 27898-06-2 | Molecular Weight | 229.66000 | |
| Density | 1.33g/cm3 | Boiling Point | 281.8ºC at 760 mmHg | |
| Molecular Formula | C10H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.2ºC | |
| Name | propan-2-yl N-(5-chloro-2-hydroxyphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 281.8ºC at 760 mmHg |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66000 |
| Flash Point | 124.2ºC |
| Exact Mass | 229.05100 |
| PSA | 62.05000 |
| LogP | 3.01610 |
| Vapour Pressure | 0.00205mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | UMISYNRSBYIDTJ-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)Nc1cc(Cl)ccc1O |
| HS Code | 2924299090 |
|---|
|
~%
N-(5-Chloro-2-h... CAS#:27898-06-2
Detail
|
| Literature: David; Lhote; Faure; Boule Water Research, 1998 , vol. 32, # 8 p. 2451 - 2461 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Methylethyl (5-chloro-2-hydroxyphenyl)carbamate |
| Carbanilic acid,5-chloro-2-hydroxy-,isopropyl ester |
| (2-Hydroxy-5-chlorophenyl)carbamic acid isopropyl ester |
| Carbamic acid,(5-chloro-2-hydroxyphenyl)-,1-methylethyl ester |
| Isopropyl-5-chlor-2-hydroxycarbanilat |
| Isopropyl-2-hydroxy-5-chlorphenylcarbaminat |