Kotanin A structure
|
Common Name | Kotanin A | ||
|---|---|---|---|---|
| CAS Number | 27909-08-6 | Molecular Weight | 438.42700 | |
| Density | 1.36g/cm3 | Boiling Point | 658.2ºC at 760 mmHg | |
| Molecular Formula | C24H22O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.5ºC | |
Use of Kotanin AKotanin is a metabolite of Aspergillus glaucus[1]. |
| Name | (+)-kotanin |
|---|---|
| Synonym | More Synonyms |
| Description | Kotanin is a metabolite of Aspergillus glaucus[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 658.2ºC at 760 mmHg |
| Molecular Formula | C24H22O8 |
| Molecular Weight | 438.42700 |
| Flash Point | 284.5ºC |
| Exact Mass | 438.13100 |
| PSA | 97.34000 |
| LogP | 4.21760 |
| Vapour Pressure | 3.39E-17mmHg at 25°C |
| Index of Refraction | 1.62 |
| InChIKey | CSJOUDOXDHMIAH-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c2c(OC)cc(=O)oc2c1-c1c(OC)cc(C)c2c(OC)cc(=O)oc12 |
| (+)-5,5'-Dimethyl-4,4',7,7'-tetramethoxy-8,8'-bicoumarin |
| 8-(4,7-dimethoxy-5-methyl-2-oxochromen-8-yl)-4,7-dimethoxy-5-methylchromen-2-one |
| (rac)-kotanin |
| 4,7,4',7'-tetramethoxy-5,5'-dimethyl-[8,8']bichromenyl-2,2'-dione |
| (rac)-4,4',7,7'-tetramethoxy-5,5'-dimethyl-2H,2'H-8,8'-bichromene-2,2'-dione |
| 8,8'-BICOUMARIN,5,5'-DIMETHYL-4,4',7,7'-TETRAMETHOXY-,(+) |