3,4-Dihydro-6-isopropyl-2H-1,5-benzoxazocin-3-ol structure
|
Common Name | 3,4-Dihydro-6-isopropyl-2H-1,5-benzoxazocin-3-ol | ||
|---|---|---|---|---|
| CAS Number | 27929-83-5 | Molecular Weight | 219.28000 | |
| Density | 1.14g/cm3 | Boiling Point | 344.6ºC at 760mmHg | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.2ºC | |
| Name | 6-propan-2-yl-3,4-dihydro-2H-1,5-benzoxazocin-3-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 344.6ºC at 760mmHg |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28000 |
| Flash Point | 162.2ºC |
| Exact Mass | 219.12600 |
| PSA | 41.82000 |
| LogP | 1.32060 |
| Vapour Pressure | 2.48E-05mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | RUHUOIYIOUUNCU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NCC(O)COc2ccccc21 |
|
~%
3,4-Dihydro-6-i... CAS#:27929-83-5 |
| Literature: Basil,B. et al. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 403 - 406 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,4-Dihydro-3-hydroxy-6-isopropyl-1,5-benzoxazocine |
| 2H-1,5-Benzoxazocine,3,4-dihydro-3-hydroxy-6-isopropyl |
| 6-isopropyl-3,4-dihydro-2H-benzo[b][1,5]oxazocin-3-ol |
| 2H-1,5-BENZOXAZOCIN-3-OL,3,4-DIHYDRO-6-ISOPROPYL |