2-(1,1,2,2-tetrafluoroethoxy)naphthalene structure
|
Common Name | 2-(1,1,2,2-tetrafluoroethoxy)naphthalene | ||
|---|---|---|---|---|
| CAS Number | 2796-08-9 | Molecular Weight | 244.18500 | |
| Density | 1.31g/cm3 | Boiling Point | 272ºC at 760mmHg | |
| Molecular Formula | C12H8F4O | Melting Point | 28-30ºC | |
| MSDS | N/A | Flash Point | 114.8ºC | |
| Name | 2-(1,1,2,2-tetrafluoroethoxy)naphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 272ºC at 760mmHg |
| Melting Point | 28-30ºC |
| Molecular Formula | C12H8F4O |
| Molecular Weight | 244.18500 |
| Flash Point | 114.8ºC |
| Exact Mass | 244.05100 |
| PSA | 9.23000 |
| LogP | 4.07650 |
| Vapour Pressure | 0.0104mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | WIZIHZWINSXQHH-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)Oc1ccc2ccccc2c1 |
| Hazard Codes | T: Toxic; |
|---|---|
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2909309090 |
|
~%
2-(1,1,2,2-tetr... CAS#:2796-08-9 |
| Literature: England,D.C. et al. Journal of the American Chemical Society, 1960 , vol. 82, p. 5116 - 5122 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| pc6772 |
| einecs 220-528-7 |