2-Chloro-6-trifluoromethylnicotinic acid structure
|
Common Name | 2-Chloro-6-trifluoromethylnicotinic acid | ||
|---|---|---|---|---|
| CAS Number | 280566-45-2 | Molecular Weight | 225.552 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 271.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H3ClF3NO2 | Melting Point | 120 °C | |
| MSDS | Chinese USA | Flash Point | 117.9±27.3 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 2-chloro-6-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 271.3±40.0 °C at 760 mmHg |
| Melting Point | 120 °C |
| Molecular Formula | C7H3ClF3NO2 |
| Molecular Weight | 225.552 |
| Flash Point | 117.9±27.3 °C |
| Exact Mass | 224.980438 |
| PSA | 50.19000 |
| LogP | 2.17 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.497 |
| InChIKey | DXRBTBMFFGEVCX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(F)(F)F)nc1Cl |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933399090 |
|
~78%
2-Chloro-6-trif... CAS#:280566-45-2 |
| Literature: Cottet, Fabrice; Schlosser, Manfred European Journal of Organic Chemistry, 2004 , # 18 p. 3793 - 3798 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloro-6-trifluoromethylpyridine-3-carboxylic acid |
| 3-Pyridinecarboxylic acid, 2-chloro-6-(trifluoromethyl)- |
| 2-Chloro-6-(trifluoromethyl)-3-pyridinecarboxylic Acid |
| 2-Chloro-6-trifuoromethyl nitrotinic acid |
| MFCD01862658 |
| 2-Chloro-6-(trifluoromethyl)nicotinic acid |
| 2-Chloro-6-trifluoromethylnicotinic acid |
| 2-chloro-6-trifluoromethyl-nicotinic acid |