2-nitro-N-(5-chloro-pyridin-2-yl)-5-methoxy-benzamide structure
|
Common Name | 2-nitro-N-(5-chloro-pyridin-2-yl)-5-methoxy-benzamide | ||
|---|---|---|---|---|
| CAS Number | 280773-16-2 | Molecular Weight | 307.689 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 433.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H10ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.0±28.7 °C | |
| Name | N-(5-Chloropyridin-2-yl)-5-methoxy-2-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 433.6±45.0 °C at 760 mmHg |
| Molecular Formula | C13H10ClN3O4 |
| Molecular Weight | 307.689 |
| Flash Point | 216.0±28.7 °C |
| Exact Mass | 307.035980 |
| PSA | 97.04000 |
| LogP | 2.17 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | CTIVJPFRQHXZGT-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c(C(=O)Nc2ccc(Cl)cn2)c1 |
| HS Code | 2933399090 |
|---|
|
~93%
2-nitro-N-(5-ch... CAS#:280773-16-2 |
| Literature: Pandya, Vrajesh; Jain, Mukul; Chakrabarti, Ganes; Soni, Hitesh; Parmar, Bhavesh; Chaugule, Balaji; Patel, Jigar; Jarag, Tushar; Joshi, Jignesh; Joshi, Nirav; Rath, Akshyaya; Unadkat, Vishal; Sharma, Bhavesh; Ajani, Haresh; Kumar, Jeevan; Sairam, Kalapatapu V.V.M.; Patel, Harilal; Patel, Pankaj European Journal of Medicinal Chemistry, 2012 , vol. 58, p. 136 - 152 |
|
~%
2-nitro-N-(5-ch... CAS#:280773-16-2 |
| Literature: Eli Lilly and Company Patent: US6635657 B1, 2003 ; US 6635657 B1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzamide, N-(5-chloro-2-pyridinyl)-5-methoxy-2-nitro- |
| N-(5-Chloro-2-pyridinyl)-5-methoxy-2-nitrobenzamide |
| 2-nitro-N-(5-chloro-pyridin-2-yl)-5-methoxy-benzamide |
| N-(5-chloropyridine-2-yl)-5-methoxy-2-nitrobenzamide |
| QC-2689 |