2-Amino-N-(5-chloro-2-pyridinyl)-5-methoxybenzamide structure
|
Common Name | 2-Amino-N-(5-chloro-2-pyridinyl)-5-methoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 280773-17-3 | Molecular Weight | 277.706 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 396.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H12ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.8±27.9 °C | |
| Name | 2-amino-N-(5-chloropyridin-2-yl)-5-methoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 396.9±42.0 °C at 760 mmHg |
| Molecular Formula | C13H12ClN3O2 |
| Molecular Weight | 277.706 |
| Flash Point | 193.8±27.9 °C |
| Exact Mass | 277.061798 |
| PSA | 80.73000 |
| LogP | 2.06 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | GCCIHZVIPXGAPR-UHFFFAOYSA-N |
| SMILES | COc1ccc(N)c(C(=O)Nc2ccc(Cl)cn2)c1 |
| HS Code | 2933399090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Amino-N-(5-chloro-2-pyridinyl)-5-methoxybenzamide |
| Benzamide, 2-amino-N-(5-chloro-2-pyridinyl)-5-methoxy- |