1H-Indole-3-ethanamine,5-methoxy-2-methyl-, hydrochloride (1:1)
1H-Indole-3-ethanamine,5-methoxy-2-methyl-, hydrochloride (1:1) structure
|
Common Name | 1H-Indole-3-ethanamine,5-methoxy-2-methyl-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 28089-03-4 | Molecular Weight | 240.72900 | |
| Density | 1.143g/cm3 | Boiling Point | 390.2ºC at 760mmHg | |
| Molecular Formula | C12H17ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 390.2ºC at 760mmHg |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.72900 |
| Flash Point | 189.8ºC |
| Exact Mass | 240.10300 |
| PSA | 51.04000 |
| LogP | 3.48840 |
| Vapour Pressure | 2.7E-06mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | XZQBKIIUUVHCLC-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c(C)c(CCN)c2c1.Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:78263-90-8
CAS#:67292-68-6This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride? |
| A: CAS number of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride is 28089-03-4. |
| Q: What is the English name of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride? |
| A: The English name of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride is 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride. |
| Q: What is the molecular weight of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride? |
| A: Molecular weight of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride is 240.72900. |
| Q: What are the downstream products of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride? |
| A: Related downstream products(CAS) of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride: 78263-90-8;67292-68-6. |
| Q: What is the InChIKey of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride? |
| A: InChIKey of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride is XZQBKIIUUVHCLC-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride? |
| A: Polar surface area (PSA) of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride is 51.04000. |
| Q: What is the LogP of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride? |
| A: LogP of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride is 3.48840. |
| Q: What is the Chinese name of 28089-03-4? |
| A: Chinese name of 28089-03-4 is 28089-03-4. |
| Q: What is the molecular formula of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride? |
| A: Molecular formula of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride is C12H17ClN2O. |
| Q: What is the SMILES notation of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride? |
| A: SMILES notation of 2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine,hydrochloride is COc1ccc2[nH]c(C)c(CCN)c2c1.Cl. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |