6-methoxy-2-methyl-1H-quinoline-4-thione structure
|
Common Name | 6-methoxy-2-methyl-1H-quinoline-4-thione | ||
|---|---|---|---|---|
| CAS Number | 28102-96-7 | Molecular Weight | 205.27600 | |
| Density | 1.24g/cm3 | Boiling Point | 323.7ºC at 760mmHg | |
| Molecular Formula | C11H11NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.6ºC | |
| Name | 6-methoxy-2-methyl-1H-quinoline-4-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 323.7ºC at 760mmHg |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.27600 |
| Flash Point | 149.6ºC |
| Exact Mass | 205.05600 |
| PSA | 57.11000 |
| LogP | 3.21440 |
| Vapour Pressure | 0.000257mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | SKSLXGCSDLWDEO-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c(C)cc(=S)c2c1 |
|
~%
6-methoxy-2-met... CAS#:28102-96-7 |
| Literature: Renfrew Journal of the American Chemical Society, 1946 , vol. 68, p. 1433,1435 |
|
~%
6-methoxy-2-met... CAS#:28102-96-7 |
| Literature: Gage, Jennifer L.; Onrust, Rene; Johnston, Derek; Osnowski, Andrew; MacDonald, Wendy; Mitchell, Lee; Ueroegdi, Laszlo; Rohde, Alex; Harbol, Kevin; Gragerov, Sasha; Dorman, Gyoergy; Wheeler, Tom; Florio, Vince; Cutshall, Neil S. Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 14 p. 4155 - 4159 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-methoxy-2-methylquinoline-4-thiol |
| 2-methyl-4-mercapto-6-methoxyquinoline |
| 6-Methoxy-2-methyl-chinolin-4-thiol |
| 6-Metossi-4-tio-2-metilchinolina [Italian] |
| 4-Mercapto-6-methoxy-2-methyl-chinolin |
| 6-Methoxy-2-methyl-4-quinolinethiol |
| 4-Quinolinethiol,6-methoxy-2-methyl |
| 6-Methoxy-4-mercapto-2-methylquinoline |