3-ethyl-6-methoxy-2-methyl-1H-quinoline-4-thione structure
|
Common Name | 3-ethyl-6-methoxy-2-methyl-1H-quinoline-4-thione | ||
|---|---|---|---|---|
| CAS Number | 332150-08-0 | Molecular Weight | 233.32900 | |
| Density | 1.18g/cm3 | Boiling Point | 347.9ºC at 760 mmHg | |
| Molecular Formula | C13H15NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.2ºC | |
| Name | 3-ethyl-6-methoxy-2-methyl-1H-quinoline-4-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 347.9ºC at 760 mmHg |
| Molecular Formula | C13H15NOS |
| Molecular Weight | 233.32900 |
| Flash Point | 164.2ºC |
| Exact Mass | 233.08700 |
| PSA | 60.92000 |
| LogP | 3.40290 |
| Index of Refraction | 1.616 |
| InChIKey | GWRODOLHHOXXKP-UHFFFAOYSA-N |
| SMILES | CCc1c(C)[nH]c2ccc(OC)cc2c1=S |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-ethyl-6-methoxy-2-methylquinoline-4-thiol |
| HMS2629K16 |