2,6,7-Trichloro-3-(trifluoromethyl)quinoxaline structure
|
Common Name | 2,6,7-Trichloro-3-(trifluoromethyl)quinoxaline | ||
|---|---|---|---|---|
| CAS Number | 281209-13-0 | Molecular Weight | 301.48000 | |
| Density | 1.68g/cm3 | Boiling Point | 312.5ºC at 760mmHg | |
| Molecular Formula | C9H2Cl3F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.8ºC | |
| Name | 2,6,7-Trichloro-3-(trifluoromethyl)quinoxaline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Boiling Point | 312.5ºC at 760mmHg |
| Molecular Formula | C9H2Cl3F3N2 |
| Molecular Weight | 301.48000 |
| Flash Point | 142.8ºC |
| Exact Mass | 299.92400 |
| PSA | 25.78000 |
| LogP | 4.60880 |
| Vapour Pressure | 0.001mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | WQRJHSXHDSMZPH-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1nc2cc(Cl)c(Cl)cc2nc1Cl |
| Hazard Codes | Xi: Irritant; |
|---|
|
~%
2,6,7-Trichloro... CAS#:281209-13-0 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 19 p. 5472 - 5478 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| PC8276 |
| 2,6,7-trichloro-3-trifluoromethylquinoxaline |