3-(m-Ethoxyphenyl)-1-methyl-3-propylpyrrolidine structure
|
Common Name | 3-(m-Ethoxyphenyl)-1-methyl-3-propylpyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 28142-70-3 | Molecular Weight | 247.37600 | |
| Density | 0.962g/cm3 | Boiling Point | 339.8ºC at 760mmHg | |
| Molecular Formula | C16H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 100.4ºC | |
| Name | 3-(3-ethoxyphenyl)-1-methyl-3-propylpyrrolidine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.962g/cm3 |
|---|---|
| Boiling Point | 339.8ºC at 760mmHg |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.37600 |
| Flash Point | 100.4ºC |
| Exact Mass | 247.19400 |
| PSA | 12.47000 |
| LogP | 3.39660 |
| Vapour Pressure | 8.99E-05mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | CRIHJKFNPYBWGV-UHFFFAOYSA-N |
| SMILES | CCCC1(c2cccc(OCC)c2)CCN(C)C1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(3-ethoxy-phenyl)-1-methyl-3-propyl-pyrrolidine |
| Pyrrolidine,3-(m-ethoxyphenyl)-1-methyl-3-propyl |
| 3-(m-Ethoxyphenyl)-1-methyl-3-propylpyrrolidine |