Ethanone,1-(4-nitrophenyl)-, hydrazone structure
|
Common Name | Ethanone,1-(4-nitrophenyl)-, hydrazone | ||
|---|---|---|---|---|
| CAS Number | 28153-22-2 | Molecular Weight | 179.17600 | |
| Density | 1.29g/cm3 | Boiling Point | 338.4ºC at 760mmHg | |
| Molecular Formula | C8H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.5ºC | |
| Name | 1-(4-nitrophenyl)ethylidenehydrazine |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 338.4ºC at 760mmHg |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.17600 |
| Flash Point | 158.5ºC |
| Exact Mass | 179.06900 |
| PSA | 84.20000 |
| LogP | 2.50100 |
| Vapour Pressure | 9.82E-05mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | AHKRDSPGMCQLDZ-POHAHGRESA-N |
| SMILES | CC(=NN)c1ccc([N+](=O)[O-])cc1 |
|
~98%
Ethanone,1-(4-n... CAS#:28153-22-2 |
| Literature: Shirinian; Belen'kii; Krayushkin Russian Chemical Bulletin, 1999 , vol. 48, # 11 p. 2171 - 2172 |
|
~%
Ethanone,1-(4-n... CAS#:28153-22-2 |
| Literature: Newkome,G.R.; Fishel,D.L. Journal of Organic Chemistry, 1966 , vol. 31, p. 677 - 681 |