N-methyl-N-[1-(4-nitrophenyl)ethylideneamino]methanamine structure
|
Common Name | N-methyl-N-[1-(4-nitrophenyl)ethylideneamino]methanamine | ||
|---|---|---|---|---|
| CAS Number | 5757-82-4 | Molecular Weight | 207.22900 | |
| Density | 1.13g/cm3 | Boiling Point | 315.4ºC at 760 mmHg | |
| Molecular Formula | C10H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.6ºC | |
| Name | N-methyl-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]methanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 315.4ºC at 760 mmHg |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.22900 |
| Flash Point | 144.6ºC |
| Exact Mass | 207.10100 |
| PSA | 61.42000 |
| LogP | 2.40360 |
| Index of Refraction | 1.547 |
| InChIKey | LGBYZKSTFGBXRL-UHFFFAOYSA-N |
| SMILES | CC(=NN(C)C)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2928000090 |
|---|
|
~%
N-methyl-N-[1-(... CAS#:5757-82-4 |
| Literature: Newkome,G.R.; Fishel,D.L. Journal of Organic Chemistry, 1966 , vol. 31, p. 677 - 681 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-nitroacenaphthene |
| p-Nitro-acenaphthalen |
| 4-nitroacenaphthene |
| 4-Nitro-acetophenon-dimethylhydrazon |
| Acenaphthylene,5-nitro |
| p-Nitroacetophenone N,N-dimethylhydrazone |
| 5-Nitro-acenaphthylene |
| 5-Nitro-acenaphthylen |