Tetriprofen structure
|
Common Name | Tetriprofen | ||
|---|---|---|---|---|
| CAS Number | 28168-10-7 | Molecular Weight | 230.30200 | |
| Density | 1.114g/cm3 | Boiling Point | 374.5ºC at 760 mmHg | |
| Molecular Formula | C15H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.4ºC | |
| Name | 2-[4-(cyclohexen-1-yl)phenyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.114g/cm3 |
|---|---|
| Boiling Point | 374.5ºC at 760 mmHg |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.30200 |
| Flash Point | 271.4ºC |
| Exact Mass | 230.13100 |
| PSA | 37.30000 |
| LogP | 3.83210 |
| Vapour Pressure | 2.83E-06mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | CVBPQTZKZQWEFX-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1ccc(C2=CCCCC2)cc1 |
|
~%
Tetriprofen CAS#:28168-10-7 |
| Literature: Ciba-Geigy Corporation Patent: US3944589 A1, 1976 ; |
|
~%
Tetriprofen CAS#:28168-10-7 |
| Literature: The Boots Company Limited Patent: US3959364 A1, 1976 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Tetriprofen [INN] |
| p-1-cyclohexen-1-ylhydratropic acid |
| 2-[4-(1-cyclohexen-1-yl)-phenyl]propionic acid |
| 47-210 [as sodium] |
| 4-Cyclohexenylhydratropasaeure |
| UNII-8JG5454O0D |
| tetriprofen |