2-(6-Methoxynaphthalen-2-yl)propanoic acid structure
|
Common Name | 2-(6-Methoxynaphthalen-2-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 23981-80-8 | Molecular Weight | 230.259 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 403.9±20.0 °C at 760 mmHg | |
| Molecular Formula | C14H14O3 | Melting Point | 157ºC | |
| MSDS | USA | Flash Point | 154.5±15.3 °C | |
Use of 2-(6-Methoxynaphthalen-2-yl)propanoic acid(±)-Naproxen ((Rac)-Naproxen) is a racemate of Naproxen (HY-15030). Naproxen is a COX-1 and COX-2 inhibitor with IC50s of 8.72 and 5.15 μM, respectively. |
| Name | 2-(6-methoxynaphthalen-2-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | (±)-Naproxen ((Rac)-Naproxen) is a racemate of Naproxen (HY-15030). Naproxen is a COX-1 and COX-2 inhibitor with IC50s of 8.72 and 5.15 μM, respectively. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 403.9±20.0 °C at 760 mmHg |
| Melting Point | 157ºC |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.259 |
| Flash Point | 154.5±15.3 °C |
| Exact Mass | 230.094299 |
| PSA | 46.53000 |
| LogP | 3.00 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | CMWTZPSULFXXJA-UHFFFAOYSA-N |
| SMILES | COc1ccc2cc(C(C)C(=O)O)ccc2c1 |
| Storage condition | Refrigerator |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2918990090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| dl-2-(6'-methoxy-2'-naphthyl)-propionic acid |
| piproxen |
| 2-(6-methoxy-naphthalen-2-yl)-propionic acid |
| DL-Naproxen |
| (+)-(S)-Naproxen |
| (2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid |
| (2S)-2-(6-Methoxy-2-naphthyl)propanoic acid |
| 2-Naphthaleneacetic acid, 6-methoxy-α-methyl-, (S)- |
| MFCD00439456 |
| 2-naphthaleneacetic acid, 6-methoxy-a-methyl-, (aS)- |
| Naproxen |
| EINECS 245-969-2 |
| Apronax |
| Naxen |
| (+)-2-(6-Methoxy-2-naphthyl)propionic acid |
| Naprius |
| (+/-)-Naproxen |
| Napren |
| Propionic acid, 2-(6-methoxy-2-naphthyl)-, (+)- |
| (+)-NAPROXEN |
| (S)-(+)-6-methoxy-α-methyl-2-naphthaleneacetic acid |
| ALEVE |
| (S)-naproxen |
| Floginax |
| Bonyl |
| 2-(6-Methoxy-2-naphthyl)propanoic acid |
| Naxyn |
| (+/-)-2-(6-Methoxy-2-naphthyl)propionic Acid |
| (±)-6-Methoxy-α-methyl-2-naphthaleneacetic Acid |
| (+)-2-(6-methoxynaphth-2-yl)-propionic acid |
| Anaprox |
| 2-Naphthaleneacetic acid, 6-methoxy-α-methyl-, (αS)- |
| 2-naphthaleneacetic acid, 6-methoxy-a-methyl- |
| 2-NAPHTHALENEACETIC ACID, 6-METHOXY-α-METHYL-, (+)- |
| NAPRELAN |
| 2-(6-Methoxy-2-naphthyl)propionic acid |
| (2S)-2-(6-Methoxynaphth-2-yl)propanoic acid |
| )-2-(6-Methoxy-2-naphthyl)propionic Acid |
| (+)-6-Methoxy-α-methyl-2-naphthaleneacetic acid |
| 2-Naphthaleneacetic acid, 6-methoxy-α-methyl- |
| (S)-(+)-Naproxen |
| Naprosyn |