2-Butenoic acid,4-[(4-hydroxyphenyl)amino]-4-oxo-, (2Z)- structure
|
Common Name | 2-Butenoic acid,4-[(4-hydroxyphenyl)amino]-4-oxo-, (2Z)- | ||
|---|---|---|---|---|
| CAS Number | 28173-23-1 | Molecular Weight | 207.183 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 520.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C10H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.7±30.1 °C | |
| Name | (Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 520.6±50.0 °C at 760 mmHg |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.183 |
| Flash Point | 268.7±30.1 °C |
| Exact Mass | 207.053162 |
| PSA | 86.63000 |
| LogP | 0.57 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | AZQFAMKEDIARJR-WAYWQWQTSA-N |
| SMILES | O=C(O)C=CC(=O)Nc1ccc(O)cc1 |
|
~%
2-Butenoic acid... CAS#:28173-23-1 |
| Literature: Lakshmi; Shivananda; Prakash, Gouda Avaji; Isloor, Arun M; Mahendra Bulletin of the Korean Chemical Society, 2012 , vol. 33, # 2 p. 473 - 482 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| (2Z)-4-[(4-Hydroxyphenyl)amino]-4-oxobut-2-enoic acid |
| 2-Butenoic acid, 4-[(4-hydroxyphenyl)amino]-4-oxo-, (2Z)- |
| 4'-hydroxymaleanilic acid |
| 4'-hydroxy maleianilic acid |
| (2Z)-4-[(4-Hydroxyphenyl)amino]-4-oxo-2-butenoic acid |