3-Amino-5-(methoxycarbonyl)benzoic acid structure
|
Common Name | 3-Amino-5-(methoxycarbonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 28179-47-7 | Molecular Weight | 195.172 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 440.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.2±25.9 °C | |
| Name | 3-amino-5-methoxycarbonylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 440.4±35.0 °C at 760 mmHg |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.172 |
| Flash Point | 220.2±25.9 °C |
| Exact Mass | 195.053162 |
| PSA | 89.62000 |
| LogP | 0.82 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | QGGKQIDRZUUHAR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(N)cc(C(=O)O)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2942000000 |
|
~94%
3-Amino-5-(meth... CAS#:28179-47-7 |
| Literature: BRISTOL-MYERS SQUIBB COMPANY Patent: WO2009/15166 A1, 2009 ; Location in patent: Page/Page column 87 ; WO 2009/015166 A1 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Amino-5-(methoxycarbonyl)benzoic acid |
| Monomethyl-5-Amino-Isophthalate |
| Methyl 3-amino-5-carboxybenzoate |
| MONOMETHYL 5-AMINOISOPHTHALATE |
| MFCD00224870 |
| 1,3-Benzenedicarboxylic acid, 5-amino-, monomethyl ester |
| 5-Aminoisophthalic acid monomethyl ester |
| 5-Amino-isophthalic acid monomethyl ester |