Acetamide,N-(5-fluoro-9H-fluoren-2-yl) structure
|
Common Name | Acetamide,N-(5-fluoro-9H-fluoren-2-yl) | ||
|---|---|---|---|---|
| CAS Number | 2823-90-7 | Molecular Weight | 241.26000 | |
| Density | 1.299g/cm3 | Boiling Point | 466.4ºC at 760 mmHg | |
| Molecular Formula | C15H12FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.9ºC | |
| Name | N-(5-fluoro-9H-fluoren-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 466.4ºC at 760 mmHg |
| Molecular Formula | C15H12FNO |
| Molecular Weight | 241.26000 |
| Flash Point | 235.9ºC |
| Exact Mass | 241.09000 |
| PSA | 29.10000 |
| LogP | 3.42830 |
| Vapour Pressure | 7.09E-09mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | CPFBPSQPYHUDIH-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc2c(c1)Cc1cccc(F)c1-2 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Carcinogenic activity on breast after oral administration of the compound
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL770577
|
|
Name: Carcinogenic activity on ear duct after oral administration
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL771496
|
|
Name: Carcinogenic activity after oral administration
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL770717
|
|
Name: Carcinogenic activity on all sites after oral administration
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL770414
|
|
Name: Carcinogenic activity on liver after oral administration of the compound
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL771452
|
| 5-Fluor-2-acetamino-fluoren |
| 5-Fluoro-2-faa |
| 5-Fluoro-2-acetylaminofluorene |