Acetamide,N-(5-fluoro-3-nitro-9H-fluoren-2-yl)- structure
|
Common Name | Acetamide,N-(5-fluoro-3-nitro-9H-fluoren-2-yl)- | ||
|---|---|---|---|---|
| CAS Number | 1427-08-3 | Molecular Weight | 286.25800 | |
| Density | 1.449g/cm3 | Boiling Point | 531.9ºC at 760 mmHg | |
| Molecular Formula | C15H11FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.5ºC | |
| Name | N-(5-fluoro-3-nitro-9H-fluoren-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.449g/cm3 |
|---|---|
| Boiling Point | 531.9ºC at 760 mmHg |
| Molecular Formula | C15H11FN2O3 |
| Molecular Weight | 286.25800 |
| Flash Point | 275.5ºC |
| Exact Mass | 286.07500 |
| PSA | 74.92000 |
| LogP | 3.85970 |
| Vapour Pressure | 2.15E-11mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | RRNRIPIDHGBVDO-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc2c(cc1[N+](=O)[O-])-c1c(F)cccc1C2 |
|
~%
Acetamide,N-(5-... CAS#:1427-08-3 |
| Literature: Journal of Organic Chemistry, , vol. 25, p. 996 - 1000 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Acetamide,N-(5-fluoro-3-nitro-9H-fluoren-2-yl) |
| Acetamide,N-(5-fluoro-3-nitrofluoren-2-yl)-(6CI,8CI) |
| 5-Fluor-3-nitro-2-acetamino-fluoren |