2,5-Cyclohexadiene-1,4-dione,2,5-dichloro-3,6-bis(4-ethylphenyl) structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-dichloro-3,6-bis(4-ethylphenyl) | ||
|---|---|---|---|---|
| CAS Number | 28293-35-8 | Molecular Weight | 385.28300 | |
| Density | 1.29g/cm3 | Boiling Point | 521ºC at 760 mmHg | |
| Molecular Formula | C22H18Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.5ºC | |
| Name | 2,5-dichloro-3,6-bis(4-ethylphenyl)cyclohexa-2,5-diene-1,4-dione |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 521ºC at 760 mmHg |
| Molecular Formula | C22H18Cl2O2 |
| Molecular Weight | 385.28300 |
| Flash Point | 217.5ºC |
| Exact Mass | 384.06800 |
| PSA | 34.14000 |
| LogP | 5.56320 |
| Vapour Pressure | 5.91E-11mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | POVNHJIIGZJLCR-UHFFFAOYSA-N |
| SMILES | CCc1ccc(C2=C(Cl)C(=O)C(c3ccc(CC)cc3)=C(Cl)C2=O)cc1 |
|
~%
2,5-Cyclohexadi... CAS#:28293-35-8 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 264 - 268 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |