4-(2-Bromoacetyl)-2,6-dimethoxyphenyl acetate structure
|
Common Name | 4-(2-Bromoacetyl)-2,6-dimethoxyphenyl acetate | ||
|---|---|---|---|---|
| CAS Number | 28294-48-6 | Molecular Weight | 317.13300 | |
| Density | 1.442 | Boiling Point | 349ºC at 760 mmHg | |
| Molecular Formula | C12H13BrO5 | Melting Point | 126-127ºC | |
| MSDS | N/A | Flash Point | 164.9ºC | |
| Name | [4-(2-bromoacetyl)-2,6-dimethoxyphenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.442 |
|---|---|
| Boiling Point | 349ºC at 760 mmHg |
| Melting Point | 126-127ºC |
| Molecular Formula | C12H13BrO5 |
| Molecular Weight | 317.13300 |
| Flash Point | 164.9ºC |
| Exact Mass | 315.99500 |
| PSA | 61.83000 |
| LogP | 2.20670 |
| Index of Refraction | 1.537 |
| InChIKey | DQLCIZRXDSMYEF-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)CBr)cc(OC)c1OC(C)=O |
| HS Code | 2915390090 |
|---|
|
~%
4-(2-Bromoacety... CAS#:28294-48-6 |
| Literature: Miksche,G. Acta Chemica Scandinavica (1947-1973), 1973 , vol. 27, p. 1355 - 1368 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 4-Acetoxy-3,5-dimethoxy-a-bromoacetophenone |
| w-Bromo-4-acetoxy-3,5-dimethoxyacetophenone |
| 4-Acetoxy-a-bromo-3,5-dimethoxyacetophenone |